C7H12BrN5O2S — CID 83025691
5-bromo-2-hydrazinyl-N',N'-dimethylpyridine-3-sulfonohydrazide (PubChem CID 83025691) has the molecular formula C7H12BrN5O2S and a molecular weight of 310.18 g/mol. Its IUPAC name is 5-bromo-2-hydrazinyl-N',N'-dimethylpyridine-3-sulfonohydrazide.
| Compound Name | 5-bromo-2-hydrazinyl-N',N'-dimethylpyridine-3-sulfonohydrazide |
|---|---|
| PubChem CID | 83025691 |
| Molecular Formula | C7H12BrN5O2S |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 5-bromo-2-hydrazinyl-N',N'-dimethylpyridine-3-sulfonohydrazide |
| SMILES | CN(C)NS(=O)(=O)c1cc(Br)cnc1NN |
| InChI | InChI=1S/C7H12BrN5O2S/c1-13(2)12-16(14,15)6-3-5(8)4-10-7(6)11-9/h3-4,12H,9H2,1-2H3,(H,10,11) |
| InChIKey | OWTQRCFSKGQEFF-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|