C11H17BrN4O2S — CID 64687857
5-bromo-2-hydrazinyl-N-(1-methylcyclopentyl)pyridine-3-sulfonamide (PubChem CID 64687857) has the molecular formula C11H17BrN4O2S and a molecular weight of 349.25 g/mol. Its IUPAC name is 5-bromo-2-hydrazinyl-N-(1-methylcyclopentyl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-hydrazinyl-N-(1-methylcyclopentyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64687857 |
| Molecular Formula | C11H17BrN4O2S |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 5-bromo-2-hydrazinyl-N-(1-methylcyclopentyl)pyridine-3-sulfonamide |
| SMILES | CC1(NS(=O)(=O)c2cc(Br)cnc2NN)CCCC1 |
| InChI | InChI=1S/C11H17BrN4O2S/c1-11(4-2-3-5-11)16-19(17,18)9-6-8(12)7-14-10(9)15-13/h6-7,16H,2-5,13H2,1H3,(H,14,15) |
| InChIKey | BHKVWWUJTBBRGO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|