C9H13BrN4O4S2 — CID 61301424
5-bromo-N-(1,1-dioxothiolan-3-yl)-2-hydrazinylpyridine-3-sulfonamide (PubChem CID 61301424) has the molecular formula C9H13BrN4O4S2 and a molecular weight of 385.27 g/mol. Its IUPAC name is 5-bromo-N-(1,1-dioxothiolan-3-yl)-2-hydrazinylpyridine-3-sulfonamide.
| Compound Name | 5-bromo-N-(1,1-dioxothiolan-3-yl)-2-hydrazinylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61301424 |
| Molecular Formula | C9H13BrN4O4S2 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | 5-bromo-N-(1,1-dioxothiolan-3-yl)-2-hydrazinylpyridine-3-sulfonamide |
| SMILES | NNc1ncc(Br)cc1S(=O)(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H13BrN4O4S2/c10-6-3-8(9(13-11)12-4-6)20(17,18)14-7-1-2-19(15,16)5-7/h3-4,7,14H,1-2,5,11H2,(H,12,13) |
| InChIKey | KLBHTBHQJUAPTE-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|