C10H15BrN4O4S2 — CID 62133630
5-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-2-hydrazinylpyridine-3-sulfonamide (PubChem CID 62133630) has the molecular formula C10H15BrN4O4S2 and a molecular weight of 399.29 g/mol. Its IUPAC name is 5-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-2-hydrazinylpyridine-3-sulfonamide.
| Compound Name | 5-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-2-hydrazinylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62133630 |
| Molecular Formula | C10H15BrN4O4S2 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | 5-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-2-hydrazinylpyridine-3-sulfonamide |
| SMILES | NNc1ncc(Br)cc1S(=O)(=O)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H15BrN4O4S2/c11-8-3-9(10(15-12)13-5-8)21(18,19)14-4-7-1-2-20(16,17)6-7/h3,5,7,14H,1-2,4,6,12H2,(H,13,15) |
| InChIKey | LKGFGSOZXBLRJA-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|