C9H13BrN4O4S2 — CID 61300085
[5-bromo-3-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-2-pyridinyl]hydrazine (PubChem CID 61300085) has the molecular formula C9H13BrN4O4S2 and a molecular weight of 385.27 g/mol. Its IUPAC name is [5-bromo-3-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-2-pyridinyl]hydrazine.
| Compound Name | [5-bromo-3-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 61300085 |
| Molecular Formula | C9H13BrN4O4S2 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | [5-bromo-3-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-2-pyridinyl]hydrazine |
| SMILES | NNc1ncc(Br)cc1S(=O)(=O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H13BrN4O4S2/c10-7-5-8(9(13-11)12-6-7)20(17,18)14-1-3-19(15,16)4-2-14/h5-6H,1-4,11H2,(H,12,13) |
| InChIKey | LNXHBBSKQVBYQU-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|