C12H19BrN4O3S — CID 106836374
1-[1-[(5-bromo-2-hydrazinyl-3-pyridinyl)sulfonyl]piperidin-4-yl]ethanol (PubChem CID 106836374) has the molecular formula C12H19BrN4O3S and a molecular weight of 379.28 g/mol. Its IUPAC name is 1-[1-[(5-bromo-2-hydrazinyl-3-pyridinyl)sulfonyl]piperidin-4-yl]ethanol.
| Compound Name | 1-[1-[(5-bromo-2-hydrazinyl-3-pyridinyl)sulfonyl]piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 106836374 |
| Molecular Formula | C12H19BrN4O3S |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 1-[1-[(5-bromo-2-hydrazinyl-3-pyridinyl)sulfonyl]piperidin-4-yl]ethanol |
| SMILES | CC(O)C1CCN(S(=O)(=O)c2cc(Br)cnc2NN)CC1 |
| InChI | InChI=1S/C12H19BrN4O3S/c1-8(18)9-2-4-17(5-3-9)21(19,20)11-6-10(13)7-15-12(11)16-14/h6-9,18H,2-5,14H2,1H3,(H,15,16) |
| InChIKey | WNZGQTVRCHNAOS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|