C14H22BrN3O2S — CID 63626897
5-bromo-N-ethyl-3-(4-methylazepan-1-yl)sulfonylpyridin-2-amine (PubChem CID 63626897) has the molecular formula C14H22BrN3O2S and a molecular weight of 376.32 g/mol. Its IUPAC name is 5-bromo-N-ethyl-3-(4-methylazepan-1-yl)sulfonylpyridin-2-amine.
| Compound Name | 5-bromo-N-ethyl-3-(4-methylazepan-1-yl)sulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 63626897 |
| Molecular Formula | C14H22BrN3O2S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 5-bromo-N-ethyl-3-(4-methylazepan-1-yl)sulfonylpyridin-2-amine |
| SMILES | CCNc1ncc(Br)cc1S(=O)(=O)N1CCCC(C)CC1 |
| InChI | InChI=1S/C14H22BrN3O2S/c1-3-16-14-13(9-12(15)10-17-14)21(19,20)18-7-4-5-11(2)6-8-18/h9-11H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | PAXQBXQVJDUZHB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |