C13H20BrN3O3S — CID 62163664
[1-[[5-bromo-2-(ethylamino)-3-pyridinyl]sulfonyl]piperidin-3-yl]methanol (PubChem CID 62163664) has the molecular formula C13H20BrN3O3S and a molecular weight of 378.29 g/mol. Its IUPAC name is [1-[[5-bromo-2-(ethylamino)-3-pyridinyl]sulfonyl]piperidin-3-yl]methanol.
| Compound Name | [1-[[5-bromo-2-(ethylamino)-3-pyridinyl]sulfonyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 62163664 |
| Molecular Formula | C13H20BrN3O3S |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | [1-[[5-bromo-2-(ethylamino)-3-pyridinyl]sulfonyl]piperidin-3-yl]methanol |
| SMILES | CCNc1ncc(Br)cc1S(=O)(=O)N1CCCC(CO)C1 |
| InChI | InChI=1S/C13H20BrN3O3S/c1-2-15-13-12(6-11(14)7-16-13)21(19,20)17-5-3-4-10(8-17)9-18/h6-7,10,18H,2-5,8-9H2,1H3,(H,15,16) |
| InChIKey | CZPHBQIVYQNOIM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |