C12H20BrN5O2S — CID 61298550
1-[(5-bromo-2-hydrazinyl-3-pyridinyl)sulfonyl]-N,N-dimethylpiperidin-4-amine (PubChem CID 61298550) has the molecular formula C12H20BrN5O2S and a molecular weight of 378.30 g/mol. Its IUPAC name is 1-[(5-bromo-2-hydrazinyl-3-pyridinyl)sulfonyl]-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-[(5-bromo-2-hydrazinyl-3-pyridinyl)sulfonyl]-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 61298550 |
| Molecular Formula | C12H20BrN5O2S |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 1-[(5-bromo-2-hydrazinyl-3-pyridinyl)sulfonyl]-N,N-dimethylpiperidin-4-amine |
| SMILES | CN(C)C1CCN(S(=O)(=O)c2cc(Br)cnc2NN)CC1 |
| InChI | InChI=1S/C12H20BrN5O2S/c1-17(2)10-3-5-18(6-4-10)21(19,20)11-7-9(13)8-15-12(11)16-14/h7-8,10H,3-6,14H2,1-2H3,(H,15,16) |
| InChIKey | AVODHIALGLQUHF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|