C11H17BrN4O3S — CID 61299120
[5-bromo-3-(4-methoxypiperidin-1-yl)sulfonyl-2-pyridinyl]hydrazine (PubChem CID 61299120) has the molecular formula C11H17BrN4O3S and a molecular weight of 365.25 g/mol. Its IUPAC name is [5-bromo-3-(4-methoxypiperidin-1-yl)sulfonyl-2-pyridinyl]hydrazine.
| Compound Name | [5-bromo-3-(4-methoxypiperidin-1-yl)sulfonyl-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 61299120 |
| Molecular Formula | C11H17BrN4O3S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | [5-bromo-3-(4-methoxypiperidin-1-yl)sulfonyl-2-pyridinyl]hydrazine |
| SMILES | COC1CCN(S(=O)(=O)c2cc(Br)cnc2NN)CC1 |
| InChI | InChI=1S/C11H17BrN4O3S/c1-19-9-2-4-16(5-3-9)20(17,18)10-6-8(12)7-14-11(10)15-13/h6-7,9H,2-5,13H2,1H3,(H,14,15) |
| InChIKey | SVMQCZMNGKBIHA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|