C11H15BrN4O3S — CID 62235486
5-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-2-hydrazinylpyridine-3-carboxamide (PubChem CID 62235486) has the molecular formula C11H15BrN4O3S and a molecular weight of 363.24 g/mol. Its IUPAC name is 5-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-2-hydrazinylpyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-2-hydrazinylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 62235486 |
| Molecular Formula | C11H15BrN4O3S |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 5-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-2-hydrazinylpyridine-3-carboxamide |
| SMILES | NNc1ncc(Br)cc1C(=O)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H15BrN4O3S/c12-8-3-9(10(16-13)14-5-8)11(17)15-4-7-1-2-20(18,19)6-7/h3,5,7H,1-2,4,6,13H2,(H,14,16)(H,15,17) |
| InChIKey | KSLMMIGNOBAMIO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|