C12H18BrN5O — CID 62238368
5-bromo-2-hydrazinyl-N-[(1-methylpyrrolidin-3-yl)methyl]pyridine-3-carboxamide (PubChem CID 62238368) has the molecular formula C12H18BrN5O and a molecular weight of 328.21 g/mol. Its IUPAC name is 5-bromo-2-hydrazinyl-N-[(1-methylpyrrolidin-3-yl)methyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-hydrazinyl-N-[(1-methylpyrrolidin-3-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62238368 |
| Molecular Formula | C12H18BrN5O |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 5-bromo-2-hydrazinyl-N-[(1-methylpyrrolidin-3-yl)methyl]pyridine-3-carboxamide |
| SMILES | CN1CCC(CNC(=O)c2cc(Br)cnc2NN)C1 |
| InChI | InChI=1S/C12H18BrN5O/c1-18-3-2-8(7-18)5-16-12(19)10-4-9(13)6-15-11(10)17-14/h4,6,8H,2-3,5,7,14H2,1H3,(H,15,17)(H,16,19) |
| InChIKey | MLDXEVFVXQTIPE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|