C13H20BrN5O — CID 62237445
5-bromo-N-[(1-ethylpyrrolidin-3-yl)methyl]-2-hydrazinylpyridine-3-carboxamide (PubChem CID 62237445) has the molecular formula C13H20BrN5O and a molecular weight of 342.24 g/mol. Its IUPAC name is 5-bromo-N-[(1-ethylpyrrolidin-3-yl)methyl]-2-hydrazinylpyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[(1-ethylpyrrolidin-3-yl)methyl]-2-hydrazinylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 62237445 |
| Molecular Formula | C13H20BrN5O |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 5-bromo-N-[(1-ethylpyrrolidin-3-yl)methyl]-2-hydrazinylpyridine-3-carboxamide |
| SMILES | CCN1CCC(CNC(=O)c2cc(Br)cnc2NN)C1 |
| InChI | InChI=1S/C13H20BrN5O/c1-2-19-4-3-9(8-19)6-17-13(20)11-5-10(14)7-16-12(11)18-15/h5,7,9H,2-4,6,8,15H2,1H3,(H,16,18)(H,17,20) |
| InChIKey | HXODQVLRYMVXPE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|