C12H13BrClNO3S — CID 47156896
5-bromo-2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide (PubChem CID 47156896) has the molecular formula C12H13BrClNO3S and a molecular weight of 366.66 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 47156896 |
| Molecular Formula | C12H13BrClNO3S |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | 5-bromo-2-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide |
| SMILES | O=C(NCC1CCS(=O)(=O)C1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C12H13BrClNO3S/c13-9-1-2-11(14)10(5-9)12(16)15-6-8-3-4-19(17,18)7-8/h1-2,5,8H,3-4,6-7H2,(H,15,16) |
| InChIKey | YZOFAOYDEQPTHX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |