C18H18BrNO4S — CID 60507504
2-(3-bromophenoxy)-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide (PubChem CID 60507504) has the molecular formula C18H18BrNO4S and a molecular weight of 424.32 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide.
| Compound Name | 2-(3-bromophenoxy)-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 60507504 |
| Molecular Formula | C18H18BrNO4S |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | 2-(3-bromophenoxy)-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide |
| SMILES | O=C(NCC1CCS(=O)(=O)C1)c1ccccc1Oc1cccc(Br)c1 |
| InChI | InChI=1S/C18H18BrNO4S/c19-14-4-3-5-15(10-14)24-17-7-2-1-6-16(17)18(21)20-11-13-8-9-25(22,23)12-13/h1-7,10,13H,8-9,11-12H2,(H,20,21) |
| InChIKey | RZFKLSTZYXUFRB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |