C15H18N2O3S — CID 62131826
2-(3-aminoprop-1-ynyl)-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide (PubChem CID 62131826) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-(3-aminoprop-1-ynyl)-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide.
| Compound Name | 2-(3-aminoprop-1-ynyl)-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 62131826 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-(3-aminoprop-1-ynyl)-N-[(1,1-dioxothiolan-3-yl)methyl]benzamide |
| SMILES | NCC#Cc1ccccc1C(=O)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18N2O3S/c16-8-3-5-13-4-1-2-6-14(13)15(18)17-10-12-7-9-21(19,20)11-12/h1-2,4,6,12H,7-11,16H2,(H,17,18) |
| InChIKey | NBWCNRQVQUZJJJ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|