C12H13ClFNO3S — CID 94006526
4-chloro-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-fluorobenzamide (PubChem CID 94006526) has the molecular formula C12H13ClFNO3S and a molecular weight of 305.76 g/mol. Its IUPAC name is 4-chloro-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-fluorobenzamide.
| Compound Name | 4-chloro-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 94006526 |
| Molecular Formula | C12H13ClFNO3S |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 4-chloro-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-fluorobenzamide |
| SMILES | O=C(NC[C@H]1CCS(=O)(=O)C1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H13ClFNO3S/c13-9-1-2-10(11(14)5-9)12(16)15-6-8-3-4-19(17,18)7-8/h1-2,5,8H,3-4,6-7H2,(H,15,16)/t8-/m1/s1 |
| InChIKey | YABIZBLQMAZVDR-MRVPVSSYSA-N |
| XLogP | 1.64 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |