C12H14ClNO4S — CID 62132347
5-chloro-2-[(1,1-dioxothiolan-3-yl)methylamino]benzoic acid (PubChem CID 62132347) has the molecular formula C12H14ClNO4S and a molecular weight of 303.77 g/mol. Its IUPAC name is 5-chloro-2-[(1,1-dioxothiolan-3-yl)methylamino]benzoic acid.
| Compound Name | 5-chloro-2-[(1,1-dioxothiolan-3-yl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 62132347 |
| Molecular Formula | C12H14ClNO4S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 5-chloro-2-[(1,1-dioxothiolan-3-yl)methylamino]benzoic acid |
| SMILES | O=C(O)c1cc(Cl)ccc1NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14ClNO4S/c13-9-1-2-11(10(5-9)12(15)16)14-6-8-3-4-19(17,18)7-8/h1-2,5,8,14H,3-4,6-7H2,(H,15,16) |
| InChIKey | LCFRASGWLHAQFP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |