C11H14N2O4S — CID 81243983
4-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxylic acid (PubChem CID 81243983) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxylic acid.
| Compound Name | 4-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81243983 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-[(1,1-dioxothiolan-3-yl)methylamino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnccc1NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H14N2O4S/c14-11(15)9-6-12-3-1-10(9)13-5-8-2-4-18(16,17)7-8/h1,3,6,8H,2,4-5,7H2,(H,12,13)(H,14,15) |
| InChIKey | ULYCZJPGELVHJO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |