3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzoic acid

C12H14N2O6S — CID 115542399

IUPAC3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzoic acid
SMILESO=C(O)c1cccc(NCC2CCS(=O)(=O)C2)c1[N+](=O)[O-]
InChIInChI=1S/C12H14N2O6S/c15-12(16)9-2-1-3-10(11(9)14(17)18)13-6-8-4-5-21(19,20)7-8/h1-3,8,13H,4-7H2,(H,15,16)
InChIKeyUJAAXOWZGSSXNB-UHFFFAOYSA-N
MW314.32 g/mol
LogP1.14
Rot. Bonds5

About 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzoic acid

3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzoic acid (PubChem CID 115542399) has the molecular formula C12H14N2O6S and a molecular weight of 314.32 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzoic acid.

Molecular Properties

Compound Name3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzoic acid
PubChem CID115542399
Molecular FormulaC12H14N2O6S
Molecular Weight314.32 g/mol
Exact Mass314.06
IUPAC Name3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzoic acid
SMILESO=C(O)c1cccc(NCC2CCS(=O)(=O)C2)c1[N+](=O)[O-]
InChIInChI=1S/C12H14N2O6S/c15-12(16)9-2-1-3-10(11(9)14(17)18)13-6-8-4-5-21(19,20)7-8/h1-3,8,13H,4-7H2,(H,15,16)
InChIKeyUJAAXOWZGSSXNB-UHFFFAOYSA-N
XLogP1.14
TPSA126.61 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.32
LogP ≤ 51.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzoic acid?
The IUPAC name of 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzoic acid (CID 115542399) is 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzoic acid.
What is the SMILES notation for 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzoic acid?
The canonical SMILES for 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzoic acid is O=C(O)c1cccc(NCC2CCS(=O)(=O)C2)c1[N+](=O)[O-].
What is the InChIKey of 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzoic acid?
The InChIKey is UJAAXOWZGSSXNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O6S/c15-12(16)9-2-1-3-10(11(9)14(17)18)13-6-8-4-5-21(19,20)7-8/h1-3,8,13H,4-7H2,(H,15,16).
What are the key properties of 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzoic acid?
3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzoic acid has a molecular weight of 314.32 g/mol, XLogP of 1.14, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-nitrobenzoic acid is sourced from PubChem (CID 115542399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).