C11H13ClN2O4S — CID 47157036
4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-nitroaniline (PubChem CID 47157036) has the molecular formula C11H13ClN2O4S and a molecular weight of 304.75 g/mol. Its IUPAC name is 4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-nitroaniline.
| Compound Name | 4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-nitroaniline |
|---|---|
| PubChem CID | 47157036 |
| Molecular Formula | C11H13ClN2O4S |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 4-chloro-N-[(1,1-dioxothiolan-3-yl)methyl]-2-nitroaniline |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13ClN2O4S/c12-9-1-2-10(11(5-9)14(15)16)13-6-8-3-4-19(17,18)7-8/h1-2,5,8,13H,3-4,6-7H2 |
| InChIKey | HWRNNAMBDLGTJI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|