C12H15ClN2O2S2 — CID 63094532
4-chloro-2-[(1,1-dioxothiolan-3-yl)methylamino]benzenecarbothioamide (PubChem CID 63094532) has the molecular formula C12H15ClN2O2S2 and a molecular weight of 318.85 g/mol. Its IUPAC name is 4-chloro-2-[(1,1-dioxothiolan-3-yl)methylamino]benzenecarbothioamide.
| Compound Name | 4-chloro-2-[(1,1-dioxothiolan-3-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 63094532 |
| Molecular Formula | C12H15ClN2O2S2 |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 4-chloro-2-[(1,1-dioxothiolan-3-yl)methylamino]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Cl)cc1NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15ClN2O2S2/c13-9-1-2-10(12(14)18)11(5-9)15-6-8-3-4-19(16,17)7-8/h1-2,5,8,15H,3-4,6-7H2,(H2,14,18) |
| InChIKey | ZTNITJJJTVXRAK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|