C12H17N3O3S — CID 62132713
2-amino-5-[(1,1-dioxothiolan-3-yl)methylamino]benzamide (PubChem CID 62132713) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-amino-5-[(1,1-dioxothiolan-3-yl)methylamino]benzamide.
| Compound Name | 2-amino-5-[(1,1-dioxothiolan-3-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 62132713 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-amino-5-[(1,1-dioxothiolan-3-yl)methylamino]benzamide |
| SMILES | NC(=O)c1cc(NCC2CCS(=O)(=O)C2)ccc1N |
| InChI | InChI=1S/C12H17N3O3S/c13-11-2-1-9(5-10(11)12(14)16)15-6-8-3-4-19(17,18)7-8/h1-2,5,8,15H,3-4,6-7,13H2,(H2,14,16) |
| InChIKey | DRKSOLIJCHHVPY-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|