C14H20N2O4S — CID 62132540
ethyl 2-amino-5-[(1,1-dioxothiolan-3-yl)methylamino]benzoate (PubChem CID 62132540) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is ethyl 2-amino-5-[(1,1-dioxothiolan-3-yl)methylamino]benzoate.
| Compound Name | ethyl 2-amino-5-[(1,1-dioxothiolan-3-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 62132540 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | ethyl 2-amino-5-[(1,1-dioxothiolan-3-yl)methylamino]benzoate |
| SMILES | CCOC(=O)c1cc(NCC2CCS(=O)(=O)C2)ccc1N |
| InChI | InChI=1S/C14H20N2O4S/c1-2-20-14(17)12-7-11(3-4-13(12)15)16-8-10-5-6-21(18,19)9-10/h3-4,7,10,16H,2,5-6,8-9,15H2,1H3 |
| InChIKey | FUXMERARJPTNCU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|