C12H18N2O2S — CID 114272163
N-[(1,1-dioxothiolan-3-yl)methyl]-2,6-dimethylpyridin-4-amine (PubChem CID 114272163) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]-2,6-dimethylpyridin-4-amine.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]-2,6-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 114272163 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]-2,6-dimethylpyridin-4-amine |
| SMILES | Cc1cc(NCC2CCS(=O)(=O)C2)cc(C)n1 |
| InChI | InChI=1S/C12H18N2O2S/c1-9-5-12(6-10(2)14-9)13-7-11-3-4-17(15,16)8-11/h5-6,11H,3-4,7-8H2,1-2H3,(H,13,14) |
| InChIKey | ICCCOZAOFYOBLZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |