C9H16N6O2S — CID 80908722
4-N-[(1,1-dioxothiolan-3-yl)methyl]-6-hydrazinylpyrimidine-2,4-diamine (PubChem CID 80908722) has the molecular formula C9H16N6O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is 4-N-[(1,1-dioxothiolan-3-yl)methyl]-6-hydrazinylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[(1,1-dioxothiolan-3-yl)methyl]-6-hydrazinylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80908722 |
| Molecular Formula | C9H16N6O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 4-N-[(1,1-dioxothiolan-3-yl)methyl]-6-hydrazinylpyrimidine-2,4-diamine |
| SMILES | NNc1cc(NCC2CCS(=O)(=O)C2)nc(N)n1 |
| InChI | InChI=1S/C9H16N6O2S/c10-9-13-7(3-8(14-9)15-11)12-4-6-1-2-18(16,17)5-6/h3,6H,1-2,4-5,11H2,(H4,10,12,13,14,15) |
| InChIKey | NPPACAYTFUOJRL-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|