C9H16N6O2S — CID 80898949
4-N-(1,1-dioxothiolan-3-yl)-6-hydrazinyl-4-N-methylpyrimidine-2,4-diamine (PubChem CID 80898949) has the molecular formula C9H16N6O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is 4-N-(1,1-dioxothiolan-3-yl)-6-hydrazinyl-4-N-methylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,1-dioxothiolan-3-yl)-6-hydrazinyl-4-N-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80898949 |
| Molecular Formula | C9H16N6O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 4-N-(1,1-dioxothiolan-3-yl)-6-hydrazinyl-4-N-methylpyrimidine-2,4-diamine |
| SMILES | CN(c1cc(NN)nc(N)n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16N6O2S/c1-15(6-2-3-18(16,17)5-6)8-4-7(14-11)12-9(10)13-8/h4,6H,2-3,5,11H2,1H3,(H3,10,12,13,14) |
| InChIKey | ZBQUUILRIKNCGY-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|