C10H14F3N5O2S — CID 114566985
N-(1,1-dioxothiolan-3-yl)-2-hydrazinyl-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 114566985) has the molecular formula C10H14F3N5O2S and a molecular weight of 325.32 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-hydrazinyl-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-hydrazinyl-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114566985 |
| Molecular Formula | C10H14F3N5O2S |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-hydrazinyl-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CN(c1cc(C(F)(F)F)nc(NN)n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H14F3N5O2S/c1-18(6-2-3-21(19,20)5-6)8-4-7(10(11,12)13)15-9(16-8)17-14/h4,6H,2-3,5,14H2,1H3,(H,15,16,17) |
| InChIKey | WSLNRAOANMLWRJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|