C18H25N5O2S — CID 112921983
2-N-[4-(dimethylamino)phenyl]-4-N-(1,1-dioxothiolan-3-yl)-4-N,6-dimethylpyrimidine-2,4-diamine (PubChem CID 112921983) has the molecular formula C18H25N5O2S and a molecular weight of 375.50 g/mol. Its IUPAC name is 2-N-[4-(dimethylamino)phenyl]-4-N-(1,1-dioxothiolan-3-yl)-4-N,6-dimethylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(dimethylamino)phenyl]-4-N-(1,1-dioxothiolan-3-yl)-4-N,6-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112921983 |
| Molecular Formula | C18H25N5O2S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-N-[4-(dimethylamino)phenyl]-4-N-(1,1-dioxothiolan-3-yl)-4-N,6-dimethylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(N(C)C2CCS(=O)(=O)C2)nc(Nc2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C18H25N5O2S/c1-13-11-17(23(4)16-9-10-26(24,25)12-16)21-18(19-13)20-14-5-7-15(8-6-14)22(2)3/h5-8,11,16H,9-10,12H2,1-4H3,(H,19,20,21) |
| InChIKey | IMMYPDRXJMDCFV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|