C17H23N5O2S — CID 112921770
2-N-[4-(dimethylamino)phenyl]-4-N-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-2,4-diamine (PubChem CID 112921770) has the molecular formula C17H23N5O2S and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-N-[4-(dimethylamino)phenyl]-4-N-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(dimethylamino)phenyl]-4-N-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112921770 |
| Molecular Formula | C17H23N5O2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-N-[4-(dimethylamino)phenyl]-4-N-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(NC2CCS(=O)(=O)C2)nc(Nc2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C17H23N5O2S/c1-12-10-16(19-14-8-9-25(23,24)11-14)21-17(18-12)20-13-4-6-15(7-5-13)22(2)3/h4-7,10,14H,8-9,11H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | ZQWLPCJJHZXVQT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|