C16H21N5O2S — CID 112895914
2-N-[4-(dimethylamino)phenyl]-4-N-(1,1-dioxothiolan-3-yl)pyrimidine-2,4-diamine (PubChem CID 112895914) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-N-[4-(dimethylamino)phenyl]-4-N-(1,1-dioxothiolan-3-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(dimethylamino)phenyl]-4-N-(1,1-dioxothiolan-3-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112895914 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-N-[4-(dimethylamino)phenyl]-4-N-(1,1-dioxothiolan-3-yl)pyrimidine-2,4-diamine |
| SMILES | CN(C)c1ccc(Nc2nccc(NC3CCS(=O)(=O)C3)n2)cc1 |
| InChI | InChI=1S/C16H21N5O2S/c1-21(2)14-5-3-12(4-6-14)19-16-17-9-7-15(20-16)18-13-8-10-24(22,23)11-13/h3-7,9,13H,8,10-11H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | HBWJMFIHIGNNRP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|