C10H16N4O2S — CID 80839228
4-N-(1,1-dioxothian-3-yl)-2-N-methylpyrimidine-2,4-diamine (PubChem CID 80839228) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is 4-N-(1,1-dioxothian-3-yl)-2-N-methylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,1-dioxothian-3-yl)-2-N-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80839228 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 4-N-(1,1-dioxothian-3-yl)-2-N-methylpyrimidine-2,4-diamine |
| SMILES | CNc1nccc(NC2CCCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C10H16N4O2S/c1-11-10-12-5-4-9(14-10)13-8-3-2-6-17(15,16)7-8/h4-5,8H,2-3,6-7H2,1H3,(H2,11,12,13,14) |
| InChIKey | OEXWQHGCAJHKDH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |