C12H18N4O2S — CID 112884026
N-(1,1-dioxothiolan-3-yl)-2-pyrrolidin-1-ylpyrimidin-4-amine (PubChem CID 112884026) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-pyrrolidin-1-ylpyrimidin-4-amine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-pyrrolidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112884026 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-pyrrolidin-1-ylpyrimidin-4-amine |
| SMILES | O=S1(=O)CCC(Nc2ccnc(N3CCCC3)n2)C1 |
| InChI | InChI=1S/C12H18N4O2S/c17-19(18)8-4-10(9-19)14-11-3-5-13-12(15-11)16-6-1-2-7-16/h3,5,10H,1-2,4,6-9H2,(H,13,14,15) |
| InChIKey | CZYXAAUTKATXQV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |