C16H18N4O2S — CID 112895858
2-(2,3-dihydroindol-1-yl)-N-(1,1-dioxothiolan-3-yl)pyrimidin-4-amine (PubChem CID 112895858) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-N-(1,1-dioxothiolan-3-yl)pyrimidin-4-amine.
| Compound Name | 2-(2,3-dihydroindol-1-yl)-N-(1,1-dioxothiolan-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112895858 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-N-(1,1-dioxothiolan-3-yl)pyrimidin-4-amine |
| SMILES | O=S1(=O)CCC(Nc2ccnc(N3CCc4ccccc43)n2)C1 |
| InChI | InChI=1S/C16H18N4O2S/c21-23(22)10-7-13(11-23)18-15-5-8-17-16(19-15)20-9-6-12-3-1-2-4-14(12)20/h1-5,8,13H,6-7,9-11H2,(H,17,18,19) |
| InChIKey | YCXFIRWEMIUVRM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |