C16H19N5 — CID 112941511
N-cyclopentyl-3-(2,3-dihydroindol-1-yl)-1,2,4-triazin-5-amine (PubChem CID 112941511) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-cyclopentyl-3-(2,3-dihydroindol-1-yl)-1,2,4-triazin-5-amine.
| Compound Name | N-cyclopentyl-3-(2,3-dihydroindol-1-yl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112941511 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-cyclopentyl-3-(2,3-dihydroindol-1-yl)-1,2,4-triazin-5-amine |
| SMILES | c1ccc2c(c1)CCN2c1nncc(NC2CCCC2)n1 |
| InChI | InChI=1S/C16H19N5/c1-4-8-14-12(5-1)9-10-21(14)16-19-15(11-17-20-16)18-13-6-2-3-7-13/h1,4-5,8,11,13H,2-3,6-7,9-10H2,(H,18,19,20) |
| InChIKey | YMBOSXNRMSUVGQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |