C20H21N5O2 — CID 112958669
3-(2,3-dihydroindol-1-yl)-N-[2-(4-methoxyphenoxy)ethyl]-1,2,4-triazin-5-amine (PubChem CID 112958669) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-yl)-N-[2-(4-methoxyphenoxy)ethyl]-1,2,4-triazin-5-amine.
| Compound Name | 3-(2,3-dihydroindol-1-yl)-N-[2-(4-methoxyphenoxy)ethyl]-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112958669 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 3-(2,3-dihydroindol-1-yl)-N-[2-(4-methoxyphenoxy)ethyl]-1,2,4-triazin-5-amine |
| SMILES | COc1ccc(OCCNc2cnnc(N3CCc4ccccc43)n2)cc1 |
| InChI | InChI=1S/C20H21N5O2/c1-26-16-6-8-17(9-7-16)27-13-11-21-19-14-22-24-20(23-19)25-12-10-15-4-2-3-5-18(15)25/h2-9,14H,10-13H2,1H3,(H,21,23,24) |
| InChIKey | JMCPHUYJXDTENW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|