C16H21N5 — CID 112939966
N-butyl-3-(3,4-dihydro-2H-quinolin-1-yl)-1,2,4-triazin-5-amine (PubChem CID 112939966) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is N-butyl-3-(3,4-dihydro-2H-quinolin-1-yl)-1,2,4-triazin-5-amine.
| Compound Name | N-butyl-3-(3,4-dihydro-2H-quinolin-1-yl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112939966 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | N-butyl-3-(3,4-dihydro-2H-quinolin-1-yl)-1,2,4-triazin-5-amine |
| SMILES | CCCCNc1cnnc(N2CCCc3ccccc32)n1 |
| InChI | InChI=1S/C16H21N5/c1-2-3-10-17-15-12-18-20-16(19-15)21-11-6-8-13-7-4-5-9-14(13)21/h4-5,7,9,12H,2-3,6,8,10-11H2,1H3,(H,17,19,20) |
| InChIKey | CWOULUVHWXOLPV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|