C19H27N5 — CID 112913500
N-[2-(3,4-dihydro-2H-quinolin-1-yl)-6-methylpyrimidin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 112913500) has the molecular formula C19H27N5 and a molecular weight of 325.46 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-2H-quinolin-1-yl)-6-methylpyrimidin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)-6-methylpyrimidin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 112913500 |
| Molecular Formula | C19H27N5 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)-6-methylpyrimidin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | Cc1cc(NCCCN(C)C)nc(N2CCCc3ccccc32)n1 |
| InChI | InChI=1S/C19H27N5/c1-15-14-18(20-11-7-12-23(2)3)22-19(21-15)24-13-6-9-16-8-4-5-10-17(16)24/h4-5,8,10,14H,6-7,9,11-13H2,1-3H3,(H,20,21,22) |
| InChIKey | SXHJQKIGXUGOFF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|