C18H14F3N5 — CID 112962943
3-(3,4-dihydro-2H-quinolin-1-yl)-N-(2,3,4-trifluorophenyl)-1,2,4-triazin-5-amine (PubChem CID 112962943) has the molecular formula C18H14F3N5 and a molecular weight of 357.34 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinolin-1-yl)-N-(2,3,4-trifluorophenyl)-1,2,4-triazin-5-amine.
| Compound Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-N-(2,3,4-trifluorophenyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112962943 |
| Molecular Formula | C18H14F3N5 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-N-(2,3,4-trifluorophenyl)-1,2,4-triazin-5-amine |
| SMILES | Fc1ccc(Nc2cnnc(N3CCCc4ccccc43)n2)c(F)c1F |
| InChI | InChI=1S/C18H14F3N5/c19-12-7-8-13(17(21)16(12)20)23-15-10-22-25-18(24-15)26-9-3-5-11-4-1-2-6-14(11)26/h1-2,4,6-8,10H,3,5,9H2,(H,23,24,25) |
| InChIKey | ASHIYVRQZKTSSB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|