C16H17F3N6O2 — CID 112957184
ethyl 4-[5-(2,3,4-trifluoroanilino)-1,2,4-triazin-3-yl]piperazine-1-carboxylate (PubChem CID 112957184) has the molecular formula C16H17F3N6O2 and a molecular weight of 382.35 g/mol. Its IUPAC name is ethyl 4-[5-(2,3,4-trifluoroanilino)-1,2,4-triazin-3-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[5-(2,3,4-trifluoroanilino)-1,2,4-triazin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 112957184 |
| Molecular Formula | C16H17F3N6O2 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | ethyl 4-[5-(2,3,4-trifluoroanilino)-1,2,4-triazin-3-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nncc(Nc3ccc(F)c(F)c3F)n2)CC1 |
| InChI | InChI=1S/C16H17F3N6O2/c1-2-27-16(26)25-7-5-24(6-8-25)15-22-12(9-20-23-15)21-11-4-3-10(17)13(18)14(11)19/h3-4,9H,2,5-8H2,1H3,(H,21,22,23) |
| InChIKey | LOAWSAXEQLAEGM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|