C20H29N7O — CID 112947157
1-[4-[5-[4-(diethylamino)-2-methylanilino]-1,2,4-triazin-3-yl]piperazin-1-yl]ethanone (PubChem CID 112947157) has the molecular formula C20H29N7O and a molecular weight of 383.50 g/mol. Its IUPAC name is 1-[4-[5-[4-(diethylamino)-2-methylanilino]-1,2,4-triazin-3-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[5-[4-(diethylamino)-2-methylanilino]-1,2,4-triazin-3-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 112947157 |
| Molecular Formula | C20H29N7O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 1-[4-[5-[4-(diethylamino)-2-methylanilino]-1,2,4-triazin-3-yl]piperazin-1-yl]ethanone |
| SMILES | CCN(CC)c1ccc(Nc2cnnc(N3CCN(C(C)=O)CC3)n2)c(C)c1 |
| InChI | InChI=1S/C20H29N7O/c1-5-25(6-2)17-7-8-18(15(3)13-17)22-19-14-21-24-20(23-19)27-11-9-26(10-12-27)16(4)28/h7-8,13-14H,5-6,9-12H2,1-4H3,(H,22,23,24) |
| InChIKey | ASWGBWBUXGGTEV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|