C20H30N6 — CID 112961452
1-N-[3-(azepan-1-yl)-1,2,4-triazin-5-yl]-4-N,4-N-diethyl-2-methylbenzene-1,4-diamine (PubChem CID 112961452) has the molecular formula C20H30N6 and a molecular weight of 354.50 g/mol. Its IUPAC name is 1-N-[3-(azepan-1-yl)-1,2,4-triazin-5-yl]-4-N,4-N-diethyl-2-methylbenzene-1,4-diamine.
| Compound Name | 1-N-[3-(azepan-1-yl)-1,2,4-triazin-5-yl]-4-N,4-N-diethyl-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 112961452 |
| Molecular Formula | C20H30N6 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 1-N-[3-(azepan-1-yl)-1,2,4-triazin-5-yl]-4-N,4-N-diethyl-2-methylbenzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(Nc2cnnc(N3CCCCCC3)n2)c(C)c1 |
| InChI | InChI=1S/C20H30N6/c1-4-25(5-2)17-10-11-18(16(3)14-17)22-19-15-21-24-20(23-19)26-12-8-6-7-9-13-26/h10-11,14-15H,4-9,12-13H2,1-3H3,(H,22,23,24) |
| InChIKey | VISROKVKFCVHFJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|