C15H19N5 — CID 112942079
N-(3-methylphenyl)-3-piperidin-1-yl-1,2,4-triazin-5-amine (PubChem CID 112942079) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is N-(3-methylphenyl)-3-piperidin-1-yl-1,2,4-triazin-5-amine.
| Compound Name | N-(3-methylphenyl)-3-piperidin-1-yl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112942079 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N-(3-methylphenyl)-3-piperidin-1-yl-1,2,4-triazin-5-amine |
| SMILES | Cc1cccc(Nc2cnnc(N3CCCCC3)n2)c1 |
| InChI | InChI=1S/C15H19N5/c1-12-6-5-7-13(10-12)17-14-11-16-19-15(18-14)20-8-3-2-4-9-20/h5-7,10-11H,2-4,8-9H2,1H3,(H,17,18,19) |
| InChIKey | BSZQPQIOONHLBS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |