C15H17Cl2N5 — CID 112961449
3-(azepan-1-yl)-N-(2,3-dichlorophenyl)-1,2,4-triazin-5-amine (PubChem CID 112961449) has the molecular formula C15H17Cl2N5 and a molecular weight of 338.24 g/mol. Its IUPAC name is 3-(azepan-1-yl)-N-(2,3-dichlorophenyl)-1,2,4-triazin-5-amine.
| Compound Name | 3-(azepan-1-yl)-N-(2,3-dichlorophenyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112961449 |
| Molecular Formula | C15H17Cl2N5 |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 3-(azepan-1-yl)-N-(2,3-dichlorophenyl)-1,2,4-triazin-5-amine |
| SMILES | Clc1cccc(Nc2cnnc(N3CCCCCC3)n2)c1Cl |
| InChI | InChI=1S/C15H17Cl2N5/c16-11-6-5-7-12(14(11)17)19-13-10-18-21-15(20-13)22-8-3-1-2-4-9-22/h5-7,10H,1-4,8-9H2,(H,19,20,21) |
| InChIKey | ZGIBQEMZCDIRTR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |