C15H18N6O — CID 112941370
N-[3-[(3-pyrrolidin-1-yl-1,2,4-triazin-5-yl)amino]phenyl]acetamide (PubChem CID 112941370) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is N-[3-[(3-pyrrolidin-1-yl-1,2,4-triazin-5-yl)amino]phenyl]acetamide.
| Compound Name | N-[3-[(3-pyrrolidin-1-yl-1,2,4-triazin-5-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112941370 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N-[3-[(3-pyrrolidin-1-yl-1,2,4-triazin-5-yl)amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2cnnc(N3CCCC3)n2)c1 |
| InChI | InChI=1S/C15H18N6O/c1-11(22)17-12-5-4-6-13(9-12)18-14-10-16-20-15(19-14)21-7-2-3-8-21/h4-6,9-10H,2-3,7-8H2,1H3,(H,17,22)(H,18,19,20) |
| InChIKey | NLAFKQAFLUTMOR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |