C16H19N5O2 — CID 112961433
3-(azepan-1-yl)-N-(1,3-benzodioxol-5-yl)-1,2,4-triazin-5-amine (PubChem CID 112961433) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-(azepan-1-yl)-N-(1,3-benzodioxol-5-yl)-1,2,4-triazin-5-amine.
| Compound Name | 3-(azepan-1-yl)-N-(1,3-benzodioxol-5-yl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112961433 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-(azepan-1-yl)-N-(1,3-benzodioxol-5-yl)-1,2,4-triazin-5-amine |
| SMILES | c1cc2c(cc1Nc1cnnc(N3CCCCCC3)n1)OCO2 |
| InChI | InChI=1S/C16H19N5O2/c1-2-4-8-21(7-3-1)16-19-15(10-17-20-16)18-12-5-6-13-14(9-12)23-11-22-13/h5-6,9-10H,1-4,7-8,11H2,(H,18,19,20) |
| InChIKey | ZCWACQAJKPIKJY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |