C15H17F2N5 — CID 112961460
3-(azepan-1-yl)-N-(3,4-difluorophenyl)-1,2,4-triazin-5-amine (PubChem CID 112961460) has the molecular formula C15H17F2N5 and a molecular weight of 305.33 g/mol. Its IUPAC name is 3-(azepan-1-yl)-N-(3,4-difluorophenyl)-1,2,4-triazin-5-amine.
| Compound Name | 3-(azepan-1-yl)-N-(3,4-difluorophenyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 112961460 |
| Molecular Formula | C15H17F2N5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 3-(azepan-1-yl)-N-(3,4-difluorophenyl)-1,2,4-triazin-5-amine |
| SMILES | Fc1ccc(Nc2cnnc(N3CCCCCC3)n2)cc1F |
| InChI | InChI=1S/C15H17F2N5/c16-12-6-5-11(9-13(12)17)19-14-10-18-21-15(20-14)22-7-3-1-2-4-8-22/h5-6,9-10H,1-4,7-8H2,(H,19,20,21) |
| InChIKey | CJSGPIGMQUUIAJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |