C14H15F2N5 — CID 112941993
N-(3,4-difluorophenyl)-5-piperidin-1-yl-1,2,4-triazin-3-amine (PubChem CID 112941993) has the molecular formula C14H15F2N5 and a molecular weight of 291.31 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-5-piperidin-1-yl-1,2,4-triazin-3-amine.
| Compound Name | N-(3,4-difluorophenyl)-5-piperidin-1-yl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112941993 |
| Molecular Formula | C14H15F2N5 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | N-(3,4-difluorophenyl)-5-piperidin-1-yl-1,2,4-triazin-3-amine |
| SMILES | Fc1ccc(Nc2nncc(N3CCCCC3)n2)cc1F |
| InChI | InChI=1S/C14H15F2N5/c15-11-5-4-10(8-12(11)16)18-14-19-13(9-17-20-14)21-6-2-1-3-7-21/h4-5,8-9H,1-3,6-7H2,(H,18,19,20) |
| InChIKey | GPBPXMUZRNBDKT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |