C16H19N5O2 — CID 112941946
methyl 4-[(5-piperidin-1-yl-1,2,4-triazin-3-yl)amino]benzoate (PubChem CID 112941946) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is methyl 4-[(5-piperidin-1-yl-1,2,4-triazin-3-yl)amino]benzoate.
| Compound Name | methyl 4-[(5-piperidin-1-yl-1,2,4-triazin-3-yl)amino]benzoate |
|---|---|
| PubChem CID | 112941946 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | methyl 4-[(5-piperidin-1-yl-1,2,4-triazin-3-yl)amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2nncc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C16H19N5O2/c1-23-15(22)12-5-7-13(8-6-12)18-16-19-14(11-17-20-16)21-9-3-2-4-10-21/h5-8,11H,2-4,9-10H2,1H3,(H,18,19,20) |
| InChIKey | PIIOTQQFLXFPOI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |