C14H14ClFN6O — CID 112946583
4-[3-(3-chloro-4-fluoroanilino)-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde (PubChem CID 112946583) has the molecular formula C14H14ClFN6O and a molecular weight of 336.76 g/mol. Its IUPAC name is 4-[3-(3-chloro-4-fluoroanilino)-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[3-(3-chloro-4-fluoroanilino)-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112946583 |
| Molecular Formula | C14H14ClFN6O |
| Molecular Weight | 336.76 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 4-[3-(3-chloro-4-fluoroanilino)-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(c2cnnc(Nc3ccc(F)c(Cl)c3)n2)CC1 |
| InChI | InChI=1S/C14H14ClFN6O/c15-11-7-10(1-2-12(11)16)18-14-19-13(8-17-20-14)22-5-3-21(9-23)4-6-22/h1-2,7-9H,3-6H2,(H,18,19,20) |
| InChIKey | ONQFBNXNUSNAEI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.76 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|